C14H19NO4S — CID 99933082
1-[5-[(4R)-4-hydroxy-4-(hydroxymethyl)azepane-1-carbonyl]thiophen-2-yl]ethanone (PubChem CID 99933082) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-[5-[(4R)-4-hydroxy-4-(hydroxymethyl)azepane-1-carbonyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[5-[(4R)-4-hydroxy-4-(hydroxymethyl)azepane-1-carbonyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 99933082 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-[5-[(4R)-4-hydroxy-4-(hydroxymethyl)azepane-1-carbonyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc(C(=O)N2CCC[C@](O)(CO)CC2)s1 |
| InChI | InChI=1S/C14H19NO4S/c1-10(17)11-3-4-12(20-11)13(18)15-7-2-5-14(19,9-16)6-8-15/h3-4,16,19H,2,5-9H2,1H3/t14-/m1/s1 |
| InChIKey | KRTAXYIHTVGJLY-CQSZACIVSA-N |
| XLogP | 1.30 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |