C23H29NO3 — CID 56891115
[4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[4-(4-propylphenyl)phenyl]methanone (PubChem CID 56891115) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is [4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[4-(4-propylphenyl)phenyl]methanone.
| Compound Name | [4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[4-(4-propylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 56891115 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-[4-(4-propylphenyl)phenyl]methanone |
| SMILES | CCCc1ccc(-c2ccc(C(=O)N3CCCC(O)(CO)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H29NO3/c1-2-4-18-5-7-19(8-6-18)20-9-11-21(12-10-20)22(26)24-15-3-13-23(27,17-25)14-16-24/h5-12,25,27H,2-4,13-17H2,1H3 |
| InChIKey | MJDFWNLUAABMHJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |