C21H30N2O — CID 131648719
(1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl)-(4-propylphenyl)methanone (PubChem CID 131648719) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is (1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl)-(4-propylphenyl)methanone.
| Compound Name | (1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl)-(4-propylphenyl)methanone |
|---|---|
| PubChem CID | 131648719 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl)-(4-propylphenyl)methanone |
| SMILES | C=CCN1CCCC12CCCN(C(=O)c1ccc(CCC)cc1)C2 |
| InChI | InChI=1S/C21H30N2O/c1-3-7-18-8-10-19(11-9-18)20(24)22-15-5-12-21(17-22)13-6-16-23(21)14-4-2/h4,8-11H,2-3,5-7,12-17H2,1H3 |
| InChIKey | JJCQYMQOQGMTFA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|