C21H29N3O2 — CID 134070533
8-[4-(dimethylamino)benzoyl]-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one (PubChem CID 134070533) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 8-[4-(dimethylamino)benzoyl]-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one.
| Compound Name | 8-[4-(dimethylamino)benzoyl]-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 134070533 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 8-[4-(dimethylamino)benzoyl]-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one |
| SMILES | C=CCN1C(=O)CCCC12CCCN(C(=O)c1ccc(N(C)C)cc1)C2 |
| InChI | InChI=1S/C21H29N3O2/c1-4-14-24-19(25)7-5-12-21(24)13-6-15-23(16-21)20(26)17-8-10-18(11-9-17)22(2)3/h4,8-11H,1,5-7,12-16H2,2-3H3 |
| InChIKey | IBXPXGNPDVUYDK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|