C20H27N3O2 — CID 134070535
N-benzyl-2-oxo-1-prop-2-enyl-1,8-diazaspiro[5.5]undecane-8-carboxamide (PubChem CID 134070535) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-benzyl-2-oxo-1-prop-2-enyl-1,8-diazaspiro[5.5]undecane-8-carboxamide.
| Compound Name | N-benzyl-2-oxo-1-prop-2-enyl-1,8-diazaspiro[5.5]undecane-8-carboxamide |
|---|---|
| PubChem CID | 134070535 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-benzyl-2-oxo-1-prop-2-enyl-1,8-diazaspiro[5.5]undecane-8-carboxamide |
| SMILES | C=CCN1C(=O)CCCC12CCCN(C(=O)NCc1ccccc1)C2 |
| InChI | InChI=1S/C20H27N3O2/c1-2-13-23-18(24)10-6-11-20(23)12-7-14-22(16-20)19(25)21-15-17-8-4-3-5-9-17/h2-5,8-9H,1,6-7,10-16H2,(H,21,25) |
| InChIKey | POIUBDZYJZKRNF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|