C22H25N3O2 — CID 97495568
(6R)-1-prop-2-enyl-8-(quinoline-6-carbonyl)-1,8-diazaspiro[5.5]undecan-2-one (PubChem CID 97495568) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (6R)-1-prop-2-enyl-8-(quinoline-6-carbonyl)-1,8-diazaspiro[5.5]undecan-2-one.
| Compound Name | (6R)-1-prop-2-enyl-8-(quinoline-6-carbonyl)-1,8-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 97495568 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (6R)-1-prop-2-enyl-8-(quinoline-6-carbonyl)-1,8-diazaspiro[5.5]undecan-2-one |
| SMILES | C=CCN1C(=O)CCC[C@]12CCCN(C(=O)c1ccc3ncccc3c1)C2 |
| InChI | InChI=1S/C22H25N3O2/c1-2-13-25-20(26)7-3-10-22(25)11-5-14-24(16-22)21(27)18-8-9-19-17(15-18)6-4-12-23-19/h2,4,6,8-9,12,15H,1,3,5,7,10-11,13-14,16H2/t22-/m1/s1 |
| InChIKey | PTZPNQGFTBQEJM-JOCHJYFZSA-N |
| XLogP | 3.41 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|