C19H23ClN2O2 — CID 131644825
8-(3-chlorobenzoyl)-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one (PubChem CID 131644825) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 8-(3-chlorobenzoyl)-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one.
| Compound Name | 8-(3-chlorobenzoyl)-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 131644825 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 8-(3-chlorobenzoyl)-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one |
| SMILES | C=CCN1C(=O)CCCC12CCCN(C(=O)c1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C19H23ClN2O2/c1-2-11-22-17(23)8-4-9-19(22)10-5-12-21(14-19)18(24)15-6-3-7-16(20)13-15/h2-3,6-7,13H,1,4-5,8-12,14H2 |
| InChIKey | QEOVAALVTNYMMA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|