C23H25ClN2O — CID 59003922
(3-chlorophenyl)-(1'-prop-2-enylspiro[1,3-dihydroisoquinoline-4,4'-piperidine]-2-yl)methanone (PubChem CID 59003922) has the molecular formula C23H25ClN2O and a molecular weight of 380.92 g/mol. Its IUPAC name is (3-chlorophenyl)-(1'-prop-2-enylspiro[1,3-dihydroisoquinoline-4,4'-piperidine]-2-yl)methanone.
| Compound Name | (3-chlorophenyl)-(1'-prop-2-enylspiro[1,3-dihydroisoquinoline-4,4'-piperidine]-2-yl)methanone |
|---|---|
| PubChem CID | 59003922 |
| Molecular Formula | C23H25ClN2O |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (3-chlorophenyl)-(1'-prop-2-enylspiro[1,3-dihydroisoquinoline-4,4'-piperidine]-2-yl)methanone |
| SMILES | C=CCN1CCC2(CC1)CN(C(=O)c1cccc(Cl)c1)Cc1ccccc12 |
| InChI | InChI=1S/C23H25ClN2O/c1-2-12-25-13-10-23(11-14-25)17-26(16-19-6-3-4-9-21(19)23)22(27)18-7-5-8-20(24)15-18/h2-9,15H,1,10-14,16-17H2 |
| InChIKey | HTFZGZYQRAATGI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|