C21H27ClN2O2 — CID 97127071
(5S)-2-(3-chlorobenzoyl)-7-cyclohexyl-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 97127071) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is (5S)-2-(3-chlorobenzoyl)-7-cyclohexyl-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5S)-2-(3-chlorobenzoyl)-7-cyclohexyl-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 97127071 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (5S)-2-(3-chlorobenzoyl)-7-cyclohexyl-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C(c1cccc(Cl)c1)N1CC[C@@]2(CCCN(C3CCCCC3)C2=O)C1 |
| InChI | InChI=1S/C21H27ClN2O2/c22-17-7-4-6-16(14-17)19(25)23-13-11-21(15-23)10-5-12-24(20(21)26)18-8-2-1-3-9-18/h4,6-7,14,18H,1-3,5,8-13,15H2/t21-/m0/s1 |
| InChIKey | MXZRAOSWIVLYQT-NRFANRHFSA-N |
| XLogP | 4.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |