C21H29N3O3 — CID 97118865
1-[(5R)-7-cyclohexyl-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione (PubChem CID 97118865) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[(5R)-7-cyclohexyl-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione.
| Compound Name | 1-[(5R)-7-cyclohexyl-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 97118865 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-[(5R)-7-cyclohexyl-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-(1-methylpyrrol-2-yl)ethane-1,2-dione |
| SMILES | Cn1cccc1C(=O)C(=O)N1CC[C@]2(CCCN(C3CCCCC3)C2=O)C1 |
| InChI | InChI=1S/C21H29N3O3/c1-22-12-5-9-17(22)18(25)19(26)23-14-11-21(15-23)10-6-13-24(20(21)27)16-7-3-2-4-8-16/h5,9,12,16H,2-4,6-8,10-11,13-15H2,1H3/t21-/m1/s1 |
| InChIKey | XUSHBELUOAUIHF-OAQYLSRUSA-N |
| XLogP | 2.38 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|