C21H27FN2O2 — CID 97138081
(5R)-7-cyclohexyl-2-(2-fluorobenzoyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 97138081) has the molecular formula C21H27FN2O2 and a molecular weight of 358.46 g/mol. Its IUPAC name is (5R)-7-cyclohexyl-2-(2-fluorobenzoyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5R)-7-cyclohexyl-2-(2-fluorobenzoyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 97138081 |
| Molecular Formula | C21H27FN2O2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (5R)-7-cyclohexyl-2-(2-fluorobenzoyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C(c1ccccc1F)N1CC[C@]2(CCCN(C3CCCCC3)C2=O)C1 |
| InChI | InChI=1S/C21H27FN2O2/c22-18-10-5-4-9-17(18)19(25)23-14-12-21(15-23)11-6-13-24(20(21)26)16-7-2-1-3-8-16/h4-5,9-10,16H,1-3,6-8,11-15H2/t21-/m1/s1 |
| InChIKey | WDCAXPNDDAXUIZ-OAQYLSRUSA-N |
| XLogP | 3.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |