C13H14ClNO — CID 166408836
2-chloro-1-spiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-ylethanone (PubChem CID 166408836) has the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. Its IUPAC name is 2-chloro-1-spiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-ylethanone.
| Compound Name | 2-chloro-1-spiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-ylethanone |
|---|---|
| PubChem CID | 166408836 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-chloro-1-spiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-ylethanone |
| SMILES | O=C(CCl)N1Cc2ccccc2C2(CC2)C1 |
| InChI | InChI=1S/C13H14ClNO/c14-7-12(16)15-8-10-3-1-2-4-11(10)13(9-15)5-6-13/h1-4H,5-9H2 |
| InChIKey | HNFHNCKWCVYSNR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|