C17H20N2O2 — CID 154871064
N-(2-oxo-2-spiro[1,3-dihydroisoquinoline-4,1'-cyclobutane]-2-ylethyl)prop-2-enamide (PubChem CID 154871064) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(2-oxo-2-spiro[1,3-dihydroisoquinoline-4,1'-cyclobutane]-2-ylethyl)prop-2-enamide.
| Compound Name | N-(2-oxo-2-spiro[1,3-dihydroisoquinoline-4,1'-cyclobutane]-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 154871064 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-(2-oxo-2-spiro[1,3-dihydroisoquinoline-4,1'-cyclobutane]-2-ylethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)N1Cc2ccccc2C2(CCC2)C1 |
| InChI | InChI=1S/C17H20N2O2/c1-2-15(20)18-10-16(21)19-11-13-6-3-4-7-14(13)17(12-19)8-5-9-17/h2-4,6-7H,1,5,8-12H2,(H,18,20) |
| InChIKey | GYQMBTIDJMASLN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|