C16H22N2O3S2 — CID 131652177
1-prop-2-enyl-8-thiophen-2-ylsulfonyl-1,8-diazaspiro[5.5]undecan-2-one (PubChem CID 131652177) has the molecular formula C16H22N2O3S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-prop-2-enyl-8-thiophen-2-ylsulfonyl-1,8-diazaspiro[5.5]undecan-2-one.
| Compound Name | 1-prop-2-enyl-8-thiophen-2-ylsulfonyl-1,8-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 131652177 |
| Molecular Formula | C16H22N2O3S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-prop-2-enyl-8-thiophen-2-ylsulfonyl-1,8-diazaspiro[5.5]undecan-2-one |
| SMILES | C=CCN1C(=O)CCCC12CCCN(S(=O)(=O)c1cccs1)C2 |
| InChI | InChI=1S/C16H22N2O3S2/c1-2-10-18-14(19)6-3-8-16(18)9-5-11-17(13-16)23(20,21)15-7-4-12-22-15/h2,4,7,12H,1,3,5-6,8-11,13H2 |
| InChIKey | YYCJWOAYLAPBSB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|