C17H23FN2O2S — CID 131644737
9-(4-fluorophenyl)sulfonyl-1-prop-2-enyl-1,9-diazaspiro[4.5]decane (PubChem CID 131644737) has the molecular formula C17H23FN2O2S and a molecular weight of 338.45 g/mol. Its IUPAC name is 9-(4-fluorophenyl)sulfonyl-1-prop-2-enyl-1,9-diazaspiro[4.5]decane.
| Compound Name | 9-(4-fluorophenyl)sulfonyl-1-prop-2-enyl-1,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 131644737 |
| Molecular Formula | C17H23FN2O2S |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 9-(4-fluorophenyl)sulfonyl-1-prop-2-enyl-1,9-diazaspiro[4.5]decane |
| SMILES | C=CCN1CCCC12CCCN(S(=O)(=O)c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C17H23FN2O2S/c1-2-11-19-12-3-9-17(19)10-4-13-20(14-17)23(21,22)16-7-5-15(18)6-8-16/h2,5-8H,1,3-4,9-14H2 |
| InChIKey | LXXUPICUWYCJHT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|