C18H23FN2O3S — CID 134070540
8-(2-fluorophenyl)sulfonyl-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one (PubChem CID 134070540) has the molecular formula C18H23FN2O3S and a molecular weight of 366.46 g/mol. Its IUPAC name is 8-(2-fluorophenyl)sulfonyl-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one.
| Compound Name | 8-(2-fluorophenyl)sulfonyl-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 134070540 |
| Molecular Formula | C18H23FN2O3S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 8-(2-fluorophenyl)sulfonyl-1-prop-2-enyl-1,8-diazaspiro[5.5]undecan-2-one |
| SMILES | C=CCN1C(=O)CCCC12CCCN(S(=O)(=O)c1ccccc1F)C2 |
| InChI | InChI=1S/C18H23FN2O3S/c1-2-12-21-17(22)9-5-10-18(21)11-6-13-20(14-18)25(23,24)16-8-4-3-7-15(16)19/h2-4,7-8H,1,5-6,9-14H2 |
| InChIKey | HMLXLNGWNGHQRP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|