C18H25FN2O2S — CID 97481900
(5R)-9-(3-fluoro-4-methylphenyl)sulfonyl-1-prop-2-enyl-1,9-diazaspiro[4.5]decane (PubChem CID 97481900) has the molecular formula C18H25FN2O2S and a molecular weight of 352.48 g/mol. Its IUPAC name is (5R)-9-(3-fluoro-4-methylphenyl)sulfonyl-1-prop-2-enyl-1,9-diazaspiro[4.5]decane.
| Compound Name | (5R)-9-(3-fluoro-4-methylphenyl)sulfonyl-1-prop-2-enyl-1,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 97481900 |
| Molecular Formula | C18H25FN2O2S |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (5R)-9-(3-fluoro-4-methylphenyl)sulfonyl-1-prop-2-enyl-1,9-diazaspiro[4.5]decane |
| SMILES | C=CCN1CCC[C@]12CCCN(S(=O)(=O)c1ccc(C)c(F)c1)C2 |
| InChI | InChI=1S/C18H25FN2O2S/c1-3-10-20-11-4-8-18(20)9-5-12-21(14-18)24(22,23)16-7-6-15(2)17(19)13-16/h3,6-7,13H,1,4-5,8-12,14H2,2H3/t18-/m1/s1 |
| InChIKey | WSOCGGHDMUSXNZ-GOSISDBHSA-N |
| XLogP | 2.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|