C15H21FN2O2S — CID 102849967
2-(2-fluorophenyl)sulfonyl-2,8-diazaspiro[5.5]undecane (PubChem CID 102849967) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfonyl-2,8-diazaspiro[5.5]undecane.
| Compound Name | 2-(2-fluorophenyl)sulfonyl-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102849967 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-(2-fluorophenyl)sulfonyl-2,8-diazaspiro[5.5]undecane |
| SMILES | O=S(=O)(c1ccccc1F)N1CCCC2(CCCNC2)C1 |
| InChI | InChI=1S/C15H21FN2O2S/c16-13-5-1-2-6-14(13)21(19,20)18-10-4-8-15(12-18)7-3-9-17-11-15/h1-2,5-6,17H,3-4,7-12H2 |
| InChIKey | DHDWKCOMDOVMQJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |