C13H18Br2N2O2S2 — CID 102849983
2-(2,5-dibromothiophen-3-yl)sulfonyl-2,8-diazaspiro[5.5]undecane (PubChem CID 102849983) has the molecular formula C13H18Br2N2O2S2 and a molecular weight of 458.24 g/mol. Its IUPAC name is 2-(2,5-dibromothiophen-3-yl)sulfonyl-2,8-diazaspiro[5.5]undecane.
| Compound Name | 2-(2,5-dibromothiophen-3-yl)sulfonyl-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102849983 |
| Molecular Formula | C13H18Br2N2O2S2 |
| Molecular Weight | 458.24 g/mol |
| Exact Mass | 455.92 |
| IUPAC Name | 2-(2,5-dibromothiophen-3-yl)sulfonyl-2,8-diazaspiro[5.5]undecane |
| SMILES | O=S(=O)(c1cc(Br)sc1Br)N1CCCC2(CCCNC2)C1 |
| InChI | InChI=1S/C13H18Br2N2O2S2/c14-11-7-10(12(15)20-11)21(18,19)17-6-2-4-13(9-17)3-1-5-16-8-13/h7,16H,1-6,8-9H2 |
| InChIKey | WQJUHOQHWCQLLV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |