C9H11Br2NO3S2 — CID 93084326
(3S)-1-(2,5-dibromothiophen-3-yl)sulfonylpiperidin-3-ol (PubChem CID 93084326) has the molecular formula C9H11Br2NO3S2 and a molecular weight of 405.13 g/mol. Its IUPAC name is (3S)-1-(2,5-dibromothiophen-3-yl)sulfonylpiperidin-3-ol.
| Compound Name | (3S)-1-(2,5-dibromothiophen-3-yl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 93084326 |
| Molecular Formula | C9H11Br2NO3S2 |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 402.85 |
| IUPAC Name | (3S)-1-(2,5-dibromothiophen-3-yl)sulfonylpiperidin-3-ol |
| SMILES | O=S(=O)(c1cc(Br)sc1Br)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C9H11Br2NO3S2/c10-8-4-7(9(11)16-8)17(14,15)12-3-1-2-6(13)5-12/h4,6,13H,1-3,5H2/t6-/m0/s1 |
| InChIKey | YQJQSCYPVDDCBX-LURJTMIESA-N |
| XLogP | 2.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |