C12H16BrNO4S2 — CID 37476994
methyl 5-bromo-4-[(3S)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 37476994) has the molecular formula C12H16BrNO4S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is methyl 5-bromo-4-[(3S)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 5-bromo-4-[(3S)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 37476994 |
| Molecular Formula | C12H16BrNO4S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | methyl 5-bromo-4-[(3S)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCC[C@H](C)C2)c(Br)s1 |
| InChI | InChI=1S/C12H16BrNO4S2/c1-8-4-3-5-14(7-8)20(16,17)10-6-9(12(15)18-2)19-11(10)13/h6,8H,3-5,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | TXTFAHCVCBTBFQ-QMMMGPOBSA-N |
| XLogP | 2.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |