C12H16BrNO5S2 — CID 42960423
methyl 5-bromo-4-(2-ethylmorpholin-4-yl)sulfonylthiophene-2-carboxylate (PubChem CID 42960423) has the molecular formula C12H16BrNO5S2 and a molecular weight of 398.30 g/mol. Its IUPAC name is methyl 5-bromo-4-(2-ethylmorpholin-4-yl)sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 5-bromo-4-(2-ethylmorpholin-4-yl)sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 42960423 |
| Molecular Formula | C12H16BrNO5S2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | methyl 5-bromo-4-(2-ethylmorpholin-4-yl)sulfonylthiophene-2-carboxylate |
| SMILES | CCC1CN(S(=O)(=O)c2cc(C(=O)OC)sc2Br)CCO1 |
| InChI | InChI=1S/C12H16BrNO5S2/c1-3-8-7-14(4-5-19-8)21(16,17)10-6-9(12(15)18-2)20-11(10)13/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | UVFDXMMDFRVMBP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |