C12H16BrNO4S2 — CID 42960419
methyl 5-bromo-4-(2-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylate (PubChem CID 42960419) has the molecular formula C12H16BrNO4S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is methyl 5-bromo-4-(2-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 5-bromo-4-(2-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 42960419 |
| Molecular Formula | C12H16BrNO4S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | methyl 5-bromo-4-(2-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCCCC2C)c(Br)s1 |
| InChI | InChI=1S/C12H16BrNO4S2/c1-8-5-3-4-6-14(8)20(16,17)10-7-9(12(15)18-2)19-11(10)13/h7-8H,3-6H2,1-2H3 |
| InChIKey | ANTFDINJJBXPAG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |