C12H16ClNO4S2 — CID 28664454
methyl 5-chloro-3-[(3R)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 28664454) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is methyl 5-chloro-3-[(3R)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 5-chloro-3-[(3R)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 28664454 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | methyl 5-chloro-3-[(3R)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(Cl)cc1S(=O)(=O)N1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C12H16ClNO4S2/c1-8-4-3-5-14(7-8)20(16,17)9-6-10(13)19-11(9)12(15)18-2/h6,8H,3-5,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | ZLNMSXGCAQPNCM-MRVPVSSYSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |