C11H17N3O3S2 — CID 26585376
3-[(3R)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carbohydrazide (PubChem CID 26585376) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-[(3R)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carbohydrazide.
| Compound Name | 3-[(3R)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 26585376 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-[(3R)-3-methylpiperidin-1-yl]sulfonylthiophene-2-carbohydrazide |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)c2ccsc2C(=O)NN)C1 |
| InChI | InChI=1S/C11H17N3O3S2/c1-8-3-2-5-14(7-8)19(16,17)9-4-6-18-10(9)11(15)13-12/h4,6,8H,2-3,5,7,12H2,1H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | AOXHIZQORCYQEA-MRVPVSSYSA-N |
| XLogP | 0.77 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|