C9H13N3O4S2 — CID 16646041
3-morpholin-4-ylsulfonylthiophene-2-carbohydrazide (PubChem CID 16646041) has the molecular formula C9H13N3O4S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-morpholin-4-ylsulfonylthiophene-2-carbohydrazide.
| Compound Name | 3-morpholin-4-ylsulfonylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 16646041 |
| Molecular Formula | C9H13N3O4S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 3-morpholin-4-ylsulfonylthiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C9H13N3O4S2/c10-11-9(13)8-7(1-6-17-8)18(14,15)12-2-4-16-5-3-12/h1,6H,2-5,10H2,(H,11,13) |
| InChIKey | ZHEYGDXAZVAGQN-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|