C13H18N2O6S2 — CID 119221163
3-[(3-morpholin-4-ylsulfonylthiophene-2-carbonyl)amino]butanoic acid (PubChem CID 119221163) has the molecular formula C13H18N2O6S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[(3-morpholin-4-ylsulfonylthiophene-2-carbonyl)amino]butanoic acid.
| Compound Name | 3-[(3-morpholin-4-ylsulfonylthiophene-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119221163 |
| Molecular Formula | C13H18N2O6S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-[(3-morpholin-4-ylsulfonylthiophene-2-carbonyl)amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H18N2O6S2/c1-9(8-11(16)17)14-13(18)12-10(2-7-22-12)23(19,20)15-3-5-21-6-4-15/h2,7,9H,3-6,8H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | GQNLYLAIBYUAOJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |