C20H28N2O4S2 — CID 38075450
N-(1-adamantylmethyl)-3-morpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 38075450) has the molecular formula C20H28N2O4S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-3-morpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 38075450 |
| Molecular Formula | C20H28N2O4S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-(1-adamantylmethyl)-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H28N2O4S2/c23-19(21-13-20-10-14-7-15(11-20)9-16(8-14)12-20)18-17(1-6-27-18)28(24,25)22-2-4-26-5-3-22/h1,6,14-16H,2-5,7-13H2,(H,21,23) |
| InChIKey | NYTZANKINNMEOT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |