C14H21N3O4S2 — CID 119386595
3-morpholin-4-ylsulfonyl-N-piperidin-4-ylthiophene-2-carboxamide (PubChem CID 119386595) has the molecular formula C14H21N3O4S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-morpholin-4-ylsulfonyl-N-piperidin-4-ylthiophene-2-carboxamide.
| Compound Name | 3-morpholin-4-ylsulfonyl-N-piperidin-4-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 119386595 |
| Molecular Formula | C14H21N3O4S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 3-morpholin-4-ylsulfonyl-N-piperidin-4-ylthiophene-2-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H21N3O4S2/c18-14(16-11-1-4-15-5-2-11)13-12(3-10-22-13)23(19,20)17-6-8-21-9-7-17/h3,10-11,15H,1-2,4-9H2,(H,16,18) |
| InChIKey | FZIKQCLVNDLDNB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |