C23H31N3O3S2 — CID 27375055
N-cyclooctyl-3-(4-phenylpiperazin-1-yl)sulfonylthiophene-2-carboxamide (PubChem CID 27375055) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-cyclooctyl-3-(4-phenylpiperazin-1-yl)sulfonylthiophene-2-carboxamide.
| Compound Name | N-cyclooctyl-3-(4-phenylpiperazin-1-yl)sulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 27375055 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-cyclooctyl-3-(4-phenylpiperazin-1-yl)sulfonylthiophene-2-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1sccc1S(=O)(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N3O3S2/c27-23(24-19-9-5-2-1-3-6-10-19)22-21(13-18-30-22)31(28,29)26-16-14-25(15-17-26)20-11-7-4-8-12-20/h4,7-8,11-13,18-19H,1-3,5-6,9-10,14-17H2,(H,24,27) |
| InChIKey | KXKGRCFQGDZHTC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |