C16H23N3O4S2 — CID 119455908
N-(8-azabicyclo[3.2.1]octan-3-yl)-3-morpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 119455908) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-3-morpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 119455908 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | O=C(NC1CC2CCC(C1)N2)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H23N3O4S2/c20-16(18-13-9-11-1-2-12(10-13)17-11)15-14(3-8-24-15)25(21,22)19-4-6-23-7-5-19/h3,8,11-13,17H,1-2,4-7,9-10H2,(H,18,20) |
| InChIKey | NVBBIFZPWRDAMJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |