C14H21N3O5S2 — CID 120945933
N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 120945933) has the molecular formula C14H21N3O5S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 120945933 |
| Molecular Formula | C14H21N3O5S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | O=C(NCC1CNCC1O)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H21N3O5S2/c18-11-9-15-7-10(11)8-16-14(19)13-12(1-6-23-13)24(20,21)17-2-4-22-5-3-17/h1,6,10-11,15,18H,2-5,7-9H2,(H,16,19) |
| InChIKey | WEBCKTQFPPOXDE-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |