C17H23F3N2O3S2 — CID 24670564
3-piperidin-1-ylsulfonyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide (PubChem CID 24670564) has the molecular formula C17H23F3N2O3S2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 3-piperidin-1-ylsulfonyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide.
| Compound Name | 3-piperidin-1-ylsulfonyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24670564 |
| Molecular Formula | C17H23F3N2O3S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-piperidin-1-ylsulfonyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCCC(C(F)(F)F)C1)c1sccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H23F3N2O3S2/c18-17(19,20)12-5-4-6-13(11-12)21-16(23)15-14(7-10-26-15)27(24,25)22-8-2-1-3-9-22/h7,10,12-13H,1-6,8-9,11H2,(H,21,23) |
| InChIKey | XUALDPBZKCNCMU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |