C22H31F3N2O3S — CID 24621442
3-[4-(azepan-1-ylsulfonyl)phenyl]-N-[3-(trifluoromethyl)cyclohexyl]propanamide (PubChem CID 24621442) has the molecular formula C22H31F3N2O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 3-[4-(azepan-1-ylsulfonyl)phenyl]-N-[3-(trifluoromethyl)cyclohexyl]propanamide.
| Compound Name | 3-[4-(azepan-1-ylsulfonyl)phenyl]-N-[3-(trifluoromethyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 24621442 |
| Molecular Formula | C22H31F3N2O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 3-[4-(azepan-1-ylsulfonyl)phenyl]-N-[3-(trifluoromethyl)cyclohexyl]propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCCCC2)cc1)NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C22H31F3N2O3S/c23-22(24,25)18-6-5-7-19(16-18)26-21(28)13-10-17-8-11-20(12-9-17)31(29,30)27-14-3-1-2-4-15-27/h8-9,11-12,18-19H,1-7,10,13-16H2,(H,26,28) |
| InChIKey | RSDFYKCELOMVDT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |