C17H20F5NO2 — CID 78848521
3-[4-(difluoromethoxy)phenyl]-N-[3-(trifluoromethyl)cyclohexyl]propanamide (PubChem CID 78848521) has the molecular formula C17H20F5NO2 and a molecular weight of 365.34 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-[3-(trifluoromethyl)cyclohexyl]propanamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-[3-(trifluoromethyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 78848521 |
| Molecular Formula | C17H20F5NO2 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-[3-(trifluoromethyl)cyclohexyl]propanamide |
| SMILES | O=C(CCc1ccc(OC(F)F)cc1)NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C17H20F5NO2/c18-16(19)25-14-7-4-11(5-8-14)6-9-15(24)23-13-3-1-2-12(10-13)17(20,21)22/h4-5,7-8,12-13,16H,1-3,6,9-10H2,(H,23,24) |
| InChIKey | NUOAYOPLIGYXKR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |