C16H22F2N2O2 — CID 120574157
3-[4-(difluoromethoxy)phenyl]-N-(2-methylpiperidin-3-yl)propanamide (PubChem CID 120574157) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-(2-methylpiperidin-3-yl)propanamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-(2-methylpiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 120574157 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-(2-methylpiperidin-3-yl)propanamide |
| SMILES | CC1NCCCC1NC(=O)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H22F2N2O2/c1-11-14(3-2-10-19-11)20-15(21)9-6-12-4-7-13(8-5-12)22-16(17)18/h4-5,7-8,11,14,16,19H,2-3,6,9-10H2,1H3,(H,20,21) |
| InChIKey | WAWZHFXDNSZWLI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |