C16H20F2N2O2 — CID 119456975
N-(8-azabicyclo[3.2.1]octan-3-yl)-2-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 119456975) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 119456975 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)F)cc1)NC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C16H20F2N2O2/c17-16(18)22-14-5-1-10(2-6-14)7-15(21)20-13-8-11-3-4-12(9-13)19-11/h1-2,5-6,11-13,16,19H,3-4,7-9H2,(H,20,21) |
| InChIKey | SBSGOCDQSBNKOU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |