C17H25ClF2N2O2 — CID 119590309
N-(2-amino-1-cyclohexylethyl)-2-[4-(difluoromethoxy)phenyl]acetamide;hydrochloride (PubChem CID 119590309) has the molecular formula C17H25ClF2N2O2 and a molecular weight of 362.85 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-[4-(difluoromethoxy)phenyl]acetamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-[4-(difluoromethoxy)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119590309 |
| Molecular Formula | C17H25ClF2N2O2 |
| Molecular Weight | 362.85 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-[4-(difluoromethoxy)phenyl]acetamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)Cc1ccc(OC(F)F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C17H24F2N2O2.ClH/c18-17(19)23-14-8-6-12(7-9-14)10-16(22)21-15(11-20)13-4-2-1-3-5-13;/h6-9,13,15,17H,1-5,10-11,20H2,(H,21,22);1H |
| InChIKey | FAPBEKJMYROSAW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |