C17H23F2NO3 — CID 75384179
N-(1-cyclohexyl-3-hydroxypropyl)-4-(difluoromethoxy)benzamide (PubChem CID 75384179) has the molecular formula C17H23F2NO3 and a molecular weight of 327.37 g/mol. Its IUPAC name is N-(1-cyclohexyl-3-hydroxypropyl)-4-(difluoromethoxy)benzamide.
| Compound Name | N-(1-cyclohexyl-3-hydroxypropyl)-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 75384179 |
| Molecular Formula | C17H23F2NO3 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-(1-cyclohexyl-3-hydroxypropyl)-4-(difluoromethoxy)benzamide |
| SMILES | O=C(NC(CCO)C1CCCCC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H23F2NO3/c18-17(19)23-14-8-6-13(7-9-14)16(22)20-15(10-11-21)12-4-2-1-3-5-12/h6-9,12,15,17,21H,1-5,10-11H2,(H,20,22) |
| InChIKey | GUMLTAXJKVNOST-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |