C16H20F3NO2 — CID 31061764
3-(2-hydroxyphenyl)-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]propanamide (PubChem CID 31061764) has the molecular formula C16H20F3NO2 and a molecular weight of 315.33 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]propanamide.
| Compound Name | 3-(2-hydroxyphenyl)-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 31061764 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-(2-hydroxyphenyl)-N-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]propanamide |
| SMILES | O=C(CCc1ccccc1O)N[C@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C16H20F3NO2/c17-16(18,19)12-5-3-6-13(10-12)20-15(22)9-8-11-4-1-2-7-14(11)21/h1-2,4,7,12-13,21H,3,5-6,8-10H2,(H,20,22)/t12-,13-/m0/s1 |
| InChIKey | PGSKNOHOLBQFGT-STQMWFEESA-N |
| XLogP | 3.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |