C15H16F3NO3 — CID 124702550
4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid (PubChem CID 124702550) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid.
| Compound Name | 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 124702550 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)N[C@@H]2CCC[C@@H](C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C15H16F3NO3/c16-15(17,18)11-2-1-3-12(8-11)19-13(20)9-4-6-10(7-5-9)14(21)22/h4-7,11-12H,1-3,8H2,(H,19,20)(H,21,22)/t11-,12-/m1/s1 |
| InChIKey | XBZVKLBCFBQACP-VXGBXAGGSA-N |
| XLogP | 3.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |