About 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid
4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid (PubChem CID 124702550) has the molecular formula C15H16F3NO3
and a molecular weight of 315.29 g/mol. Its IUPAC name is 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid |
| PubChem CID | 124702550 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)N[C@@H]2CCC[C@@H](C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C15H16F3NO3/c16-15(17,18)11-2-1-3-12(8-11)19-13(20)9-4-6-10(7-5-9)14(21)22/h4-7,11-12H,1-3,8H2,(H,19,20)(H,21,22)/t11-,12-/m1/s1 |
| InChIKey | XBZVKLBCFBQACP-VXGBXAGGSA-N |
| XLogP | 3.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid?
The IUPAC name of 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid (CID 124702550) is 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid.
What is the SMILES notation for 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid?
The canonical SMILES for 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid is O=C(O)c1ccc(C(=O)N[C@@H]2CCC[C@@H](C(F)(F)F)C2)cc1.
What is the InChIKey of 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid?
The InChIKey is XBZVKLBCFBQACP-VXGBXAGGSA-N. The full InChI is InChI=1S/C15H16F3NO3/c16-15(17,18)11-2-1-3-12(8-11)19-13(20)9-4-6-10(7-5-9)14(21)22/h4-7,11-12H,1-3,8H2,(H,19,20)(H,21,22)/t11-,12-/m1/s1.
What are the key properties of 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid?
4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid has a molecular weight of 315.29 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,3R)-3-(trifluoromethyl)cyclohexyl]carbamoyl]benzoic acid is sourced from PubChem (CID 124702550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).