C13H15F3N2O3 — CID 99783439
4-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]furan-2,4-dicarboxamide (PubChem CID 99783439) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is 4-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]furan-2,4-dicarboxamide.
| Compound Name | 4-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]furan-2,4-dicarboxamide |
|---|---|
| PubChem CID | 99783439 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-N-[(1R,3R)-3-(trifluoromethyl)cyclohexyl]furan-2,4-dicarboxamide |
| SMILES | NC(=O)c1cc(C(=O)N[C@@H]2CCC[C@@H](C(F)(F)F)C2)co1 |
| InChI | InChI=1S/C13H15F3N2O3/c14-13(15,16)8-2-1-3-9(5-8)18-12(20)7-4-10(11(17)19)21-6-7/h4,6,8-9H,1-3,5H2,(H2,17,19)(H,18,20)/t8-,9-/m1/s1 |
| InChIKey | XIKPVTSPUXZROC-RKDXNWHRSA-N |
| XLogP | 2.23 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |