C17H26N4O3S — CID 134115013
1-cyclohexyl-3-(4-phenylpiperazin-1-yl)sulfonylurea (PubChem CID 134115013) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-phenylpiperazin-1-yl)sulfonylurea.
| Compound Name | 1-cyclohexyl-3-(4-phenylpiperazin-1-yl)sulfonylurea |
|---|---|
| PubChem CID | 134115013 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-cyclohexyl-3-(4-phenylpiperazin-1-yl)sulfonylurea |
| SMILES | O=C(NC1CCCCC1)NS(=O)(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H26N4O3S/c22-17(18-15-7-3-1-4-8-15)19-25(23,24)21-13-11-20(12-14-21)16-9-5-2-6-10-16/h2,5-6,9-10,15H,1,3-4,7-8,11-14H2,(H2,18,19,22) |
| InChIKey | NHZGRDFGLTWPEL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |