C20H30N4O2 — CID 42268287
N'-cyclohexyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]oxamide (PubChem CID 42268287) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N'-cyclohexyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]oxamide.
| Compound Name | N'-cyclohexyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 42268287 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N'-cyclohexyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]oxamide |
| SMILES | O=C(NCCN1CCN(c2ccccc2)CC1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H30N4O2/c25-19(20(26)22-17-7-3-1-4-8-17)21-11-12-23-13-15-24(16-14-23)18-9-5-2-6-10-18/h2,5-6,9-10,17H,1,3-4,7-8,11-16H2,(H,21,25)(H,22,26) |
| InChIKey | GRUGYERECSLDHA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|