C24H40Cl2N4O — CID 134118089
N-cyclohexyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-carboxamide;dihydrochloride (PubChem CID 134118089) has the molecular formula C24H40Cl2N4O and a molecular weight of 471.52 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-carboxamide;dihydrochloride.
| Compound Name | N-cyclohexyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 134118089 |
| Molecular Formula | C24H40Cl2N4O |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | N-cyclohexyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CCCCC1)N1CCCCC1CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H38N4O.2ClH/c29-24(25-21-9-3-1-4-10-21)28-15-8-7-13-23(28)14-16-26-17-19-27(20-18-26)22-11-5-2-6-12-22;;/h2,5-6,11-12,21,23H,1,3-4,7-10,13-20H2,(H,25,29);2*1H |
| InChIKey | OXEZJOWJCFUWRI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |