C22H38Cl2N4O — CID 134118087
N-butyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-carboxamide;dihydrochloride (PubChem CID 134118087) has the molecular formula C22H38Cl2N4O and a molecular weight of 445.48 g/mol. Its IUPAC name is N-butyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-carboxamide;dihydrochloride.
| Compound Name | N-butyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 134118087 |
| Molecular Formula | C22H38Cl2N4O |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-butyl-2-[2-(4-phenylpiperazin-1-yl)ethyl]piperidine-1-carboxamide;dihydrochloride |
| SMILES | CCCCNC(=O)N1CCCCC1CCN1CCN(c2ccccc2)CC1.Cl.Cl |
| InChI | InChI=1S/C22H36N4O.2ClH/c1-2-3-13-23-22(27)26-14-8-7-11-21(26)12-15-24-16-18-25(19-17-24)20-9-5-4-6-10-20;;/h4-6,9-10,21H,2-3,7-8,11-19H2,1H3,(H,23,27);2*1H |
| InChIKey | QNBSPOCQACTAPB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|