C18H25FN4O2 — CID 42390559
N'-cyclopropyl-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]oxamide (PubChem CID 42390559) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is N'-cyclopropyl-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]oxamide |
|---|---|
| PubChem CID | 42390559 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N'-cyclopropyl-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]oxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(F)cc2)CC1)C(=O)NC1CC1 |
| InChI | InChI=1S/C18H25FN4O2/c19-14-2-6-16(7-3-14)23-12-10-22(11-13-23)9-1-8-20-17(24)18(25)21-15-4-5-15/h2-3,6-7,15H,1,4-5,8-13H2,(H,20,24)(H,21,25) |
| InChIKey | MMIJUQZCWTWUGZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|