C18H22FN3OS — CID 42224892
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]thiophene-2-carboxamide (PubChem CID 42224892) has the molecular formula C18H22FN3OS and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42224892 |
| Molecular Formula | C18H22FN3OS |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(F)cc2)CC1)c1cccs1 |
| InChI | InChI=1S/C18H22FN3OS/c19-15-4-6-16(7-5-15)22-12-10-21(11-13-22)9-2-8-20-18(23)17-3-1-14-24-17/h1,3-7,14H,2,8-13H2,(H,20,23) |
| InChIKey | FSCKBTCIQDNJNO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|