C17H24N2O6S — CID 119221567
3-[(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)amino]butanoic acid (PubChem CID 119221567) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is 3-[(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)amino]butanoic acid.
| Compound Name | 3-[(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119221567 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-[(4-ethyl-3-morpholin-4-ylsulfonylbenzoyl)amino]butanoic acid |
| SMILES | CCc1ccc(C(=O)NC(C)CC(=O)O)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H24N2O6S/c1-3-13-4-5-14(17(22)18-12(2)10-16(20)21)11-15(13)26(23,24)19-6-8-25-9-7-19/h4-5,11-12H,3,6-10H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | MALDPGCYWMXQIA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |