C8H9Br2NO2S2 — CID 60652131
1-(2,5-dibromothiophen-3-yl)sulfonylpyrrolidine (PubChem CID 60652131) has the molecular formula C8H9Br2NO2S2 and a molecular weight of 375.11 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)sulfonylpyrrolidine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 60652131 |
| Molecular Formula | C8H9Br2NO2S2 |
| Molecular Weight | 375.11 g/mol |
| Exact Mass | 372.84 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1cc(Br)sc1Br)N1CCCC1 |
| InChI | InChI=1S/C8H9Br2NO2S2/c9-7-5-6(8(10)14-7)15(12,13)11-3-1-2-4-11/h5H,1-4H2 |
| InChIKey | RYFUDIUILZXTQA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |